C23H15F2N5O3S — CID 3786078
4-fluoro-N-[4-(4-fluorophenyl)-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide (PubChem CID 3786078) has the molecular formula C23H15F2N5O3S and a molecular weight of 479.47 g/mol. Its IUPAC name is 4-fluoro-N-[4-(4-fluorophenyl)-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide.
| Compound Name | 4-fluoro-N-[4-(4-fluorophenyl)-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 3786078 |
| Molecular Formula | C23H15F2N5O3S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 4-fluoro-N-[4-(4-fluorophenyl)-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide |
| SMILES | O=C(Nc1sc(NN=Cc2cccc([N+](=O)[O-])c2)nc1-c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H15F2N5O3S/c24-17-8-4-15(5-9-17)20-22(28-21(31)16-6-10-18(25)11-7-16)34-23(27-20)29-26-13-14-2-1-3-19(12-14)30(32)33/h1-13H,(H,27,29)(H,28,31) |
| InChIKey | KRPGFJCKMJCXTK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|