C15H9N5O5S — CID 4293048
6-nitro-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-benzothiazin-4-one (PubChem CID 4293048) has the molecular formula C15H9N5O5S and a molecular weight of 371.33 g/mol. Its IUPAC name is 6-nitro-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-benzothiazin-4-one.
| Compound Name | 6-nitro-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 4293048 |
| Molecular Formula | C15H9N5O5S |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 6-nitro-2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(NN=Cc2cccc([N+](=O)[O-])c2)sc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H9N5O5S/c21-14-12-7-11(20(24)25)4-5-13(12)26-15(17-14)18-16-8-9-2-1-3-10(6-9)19(22)23/h1-8H,(H,17,18,21) |
| InChIKey | DEFQNOWNUCRBFX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|