C21H12N6O4S3 — CID 6034265
N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 6034265) has the molecular formula C21H12N6O4S3 and a molecular weight of 508.57 g/mol. Its IUPAC name is N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6034265 |
| Molecular Formula | C21H12N6O4S3 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | N-[(Z)-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(N/N=C\c3ccc(Sc4nc5ccccc5s4)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C21H12N6O4S3/c28-26(29)13-6-7-15-19(10-13)32-20(23-15)25-22-11-12-5-8-18(16(9-12)27(30)31)34-21-24-14-3-1-2-4-17(14)33-21/h1-11H,(H,23,25)/b22-11- |
| InChIKey | FTNDLLZEIIQPIP-JJFYIABZSA-N |
| XLogP | 6.32 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|