C19H11N5O6S2 — CID 6863404
N-[(E)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 6863404) has the molecular formula C19H11N5O6S2 and a molecular weight of 469.46 g/mol. Its IUPAC name is N-[(E)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6863404 |
| Molecular Formula | C19H11N5O6S2 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | N-[(E)-[3-nitro-4-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2nc3ccc([N+](=O)[O-])cc3s2)c([N+](=O)[O-])c1)c1ccco1 |
| InChI | InChI=1S/C19H11N5O6S2/c25-18(15-2-1-7-30-15)22-20-10-11-3-6-16(14(8-11)24(28)29)31-19-21-13-5-4-12(23(26)27)9-17(13)32-19/h1-10H,(H,22,25)/b20-10+ |
| InChIKey | YOPKCMGJQLZJJE-KEBDBYFISA-N |
| XLogP | 4.62 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|