C30H21N5O3S4 — CID 3912192
2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-benzylacetamide (PubChem CID 3912192) has the molecular formula C30H21N5O3S4 and a molecular weight of 627.80 g/mol. Its IUPAC name is 2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-benzylacetamide.
| Compound Name | 2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-benzylacetamide |
|---|---|
| PubChem CID | 3912192 |
| Molecular Formula | C30H21N5O3S4 |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | 2-[[6-[[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-benzylacetamide |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Sc4nc5ccccc5s4)c([N+](=O)[O-])c3)cc2s1)NCc1ccccc1 |
| InChI | InChI=1S/C30H21N5O3S4/c36-28(32-16-19-6-2-1-3-7-19)18-39-29-33-23-12-11-21(15-27(23)42-29)31-17-20-10-13-26(24(14-20)35(37)38)41-30-34-22-8-4-5-9-25(22)40-30/h1-15,17H,16,18H2,(H,32,36)/b31-17+ |
| InChIKey | UBWICZRFZZKOOO-KBVAKVRCSA-N |
| XLogP | 8.12 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|