C34H22N4O3S3 — CID 99654782
1-(9H-fluoren-3-yl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone (PubChem CID 99654782) has the molecular formula C34H22N4O3S3 and a molecular weight of 630.78 g/mol. Its IUPAC name is 1-(9H-fluoren-3-yl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(9H-fluoren-3-yl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 99654782 |
| Molecular Formula | C34H22N4O3S3 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | 1-(9H-fluoren-3-yl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Sc4ccccn4)c([N+](=O)[O-])c3)cc2s1)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C34H22N4O3S3/c39-30(24-10-9-23-16-22-5-1-2-6-26(22)27(23)17-24)20-42-34-37-28-12-11-25(18-32(28)44-34)36-19-21-8-13-31(29(15-21)38(40)41)43-33-7-3-4-14-35-33/h1-15,17-19H,16,20H2/b36-19+ |
| InChIKey | ZNFNSVQFVTULCB-ODNPBWNPSA-N |
| XLogP | 9.05 |
| TPSA | 98.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|