C27H18FN5O3S3 — CID 98114648
N-(4-fluorophenyl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 98114648) has the molecular formula C27H18FN5O3S3 and a molecular weight of 575.67 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 98114648 |
| Molecular Formula | C27H18FN5O3S3 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.06 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[6-[(3-nitro-4-pyridin-2-ylsulfanylphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3ccc(Sc4ccccn4)c([N+](=O)[O-])c3)cc2s1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H18FN5O3S3/c28-18-5-7-19(8-6-18)31-25(34)16-37-27-32-21-10-9-20(14-24(21)39-27)30-15-17-4-11-23(22(13-17)33(35)36)38-26-3-1-2-12-29-26/h1-15H,16H2,(H,31,34)/b30-15+ |
| InChIKey | YORYUCJJFNHIDB-FJEPWZHXSA-N |
| XLogP | 7.37 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|