C22H15N5O6S2 — CID 135723292
2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 135723292) has the molecular formula C22H15N5O6S2 and a molecular weight of 509.53 g/mol. Its IUPAC name is 2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135723292 |
| Molecular Formula | C22H15N5O6S2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | 2-[[6-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(/N=C/c3cc([N+](=O)[O-])ccc3O)cc2s1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15N5O6S2/c28-19-8-6-15(26(30)31)9-13(19)11-23-14-5-7-17-20(10-14)35-22(25-17)34-12-21(29)24-16-3-1-2-4-18(16)27(32)33/h1-11,28H,12H2,(H,24,29)/b23-11+ |
| InChIKey | MMDSJWIPJNMDLR-FOKLQQMPSA-N |
| XLogP | 5.30 |
| TPSA | 160.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|