C23H17ClN4O5S2 — CID 135845975
2-[[6-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 135845975) has the molecular formula C23H17ClN4O5S2 and a molecular weight of 529.00 g/mol. Its IUPAC name is 2-[[6-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[6-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 135845975 |
| Molecular Formula | C23H17ClN4O5S2 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 2-[[6-[(5-chloro-2-hydroxyphenyl)methylideneamino]-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3ccc(/N=C/c4cc(Cl)ccc4O)cc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17ClN4O5S2/c1-33-16-4-6-17(19(10-16)28(31)32)26-22(30)12-34-23-27-18-5-3-15(9-21(18)35-23)25-11-13-8-14(24)2-7-20(13)29/h2-11,29H,12H2,1H3,(H,26,30)/b25-11+ |
| InChIKey | HWXXKIFEINTMAD-OPEKNORGSA-N |
| XLogP | 6.05 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|