C23H23N5O5S4 — CID 126343621
[2-[[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 126343621) has the molecular formula C23H23N5O5S4 and a molecular weight of 577.74 g/mol. Its IUPAC name is [2-[[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 126343621 |
| Molecular Formula | C23H23N5O5S4 |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | [2-[[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]amino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(NC(=O)CSc2nc3ccc(NC(=O)CSC(=S)N4CCCC4)cc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23N5O5S4/c1-33-15-5-7-16(18(11-15)28(31)32)25-21(30)12-35-22-26-17-6-4-14(10-19(17)37-22)24-20(29)13-36-23(34)27-8-2-3-9-27/h4-7,10-11H,2-3,8-9,12-13H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | UIWYTJZOTXALHC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|