C15H17N3O3S4 — CID 3730646
methyl 2-[[6-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]acetate (PubChem CID 3730646) has the molecular formula C15H17N3O3S4 and a molecular weight of 415.59 g/mol. Its IUPAC name is methyl 2-[[6-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[6-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 3730646 |
| Molecular Formula | C15H17N3O3S4 |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | methyl 2-[[6-[[2-(dimethylcarbamothioylsulfanyl)acetyl]amino]-1,3-benzothiazol-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc2ccc(NC(=O)CSC(=S)N(C)C)cc2s1 |
| InChI | InChI=1S/C15H17N3O3S4/c1-18(2)15(22)24-7-12(19)16-9-4-5-10-11(6-9)25-14(17-10)23-8-13(20)21-3/h4-6H,7-8H2,1-3H3,(H,16,19) |
| InChIKey | UTDPFOPZUAIOOG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|