C10H8N2O4S2 — CID 878284
methyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetate (PubChem CID 878284) has the molecular formula C10H8N2O4S2 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetate.
| Compound Name | methyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 878284 |
| Molecular Formula | C10H8N2O4S2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | methyl 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C10H8N2O4S2/c1-16-9(13)5-17-10-11-7-3-2-6(12(14)15)4-8(7)18-10/h2-4H,5H2,1H3 |
| InChIKey | ODJFMVUDWJDBPS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|