C17H14N2O5S2 — CID 8916136
1-(2,4-dimethoxyphenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethanone (PubChem CID 8916136) has the molecular formula C17H14N2O5S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 8916136 |
| Molecular Formula | C17H14N2O5S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]ethanone |
| SMILES | COc1ccc(C(=O)CSc2nc3ccc([N+](=O)[O-])cc3s2)c(OC)c1 |
| InChI | InChI=1S/C17H14N2O5S2/c1-23-11-4-5-12(15(8-11)24-2)14(20)9-25-17-18-13-6-3-10(19(21)22)7-16(13)26-17/h3-8H,9H2,1-2H3 |
| InChIKey | FUVJONAGDOZMPE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|