C12H11N3O5S2 — CID 7854280
ethyl N-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]carbamate (PubChem CID 7854280) has the molecular formula C12H11N3O5S2 and a molecular weight of 341.37 g/mol. Its IUPAC name is ethyl N-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]carbamate |
|---|---|
| PubChem CID | 7854280 |
| Molecular Formula | C12H11N3O5S2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | ethyl N-[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CSc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C12H11N3O5S2/c1-2-20-11(17)14-10(16)6-21-12-13-8-4-3-7(15(18)19)5-9(8)22-12/h3-5H,2,6H2,1H3,(H,14,16,17) |
| InChIKey | OFFRYOBSTOISEQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|