C17H20N4O4S2 — CID 8916342
N-[[(1S,2S)-2-methylcyclohexyl]carbamoyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide (PubChem CID 8916342) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[[(1S,2S)-2-methylcyclohexyl]carbamoyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[[(1S,2S)-2-methylcyclohexyl]carbamoyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8916342 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[[(1S,2S)-2-methylcyclohexyl]carbamoyl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)NC(=O)CSc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C17H20N4O4S2/c1-10-4-2-3-5-12(10)18-16(23)20-15(22)9-26-17-19-13-7-6-11(21(24)25)8-14(13)27-17/h6-8,10,12H,2-5,9H2,1H3,(H2,18,20,22,23)/t10-,12-/m0/s1 |
| InChIKey | SDTQKVJYJWKOBS-JQWIXIFHSA-N |
| XLogP | 3.70 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|