C15H16N4O4S2 — CID 7854277
N-(cyclopentylcarbamoyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide (PubChem CID 7854277) has the molecular formula C15H16N4O4S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(cyclopentylcarbamoyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(cyclopentylcarbamoyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7854277 |
| Molecular Formula | C15H16N4O4S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-(cyclopentylcarbamoyl)-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc([N+](=O)[O-])cc2s1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H16N4O4S2/c20-13(18-14(21)16-9-3-1-2-4-9)8-24-15-17-11-6-5-10(19(22)23)7-12(11)25-15/h5-7,9H,1-4,8H2,(H2,16,18,20,21) |
| InChIKey | LEWRBZGRLZVHDS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|