C20H14N4O5S2 — CID 3434453
N-cyclopropyl-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 3434453) has the molecular formula C20H14N4O5S2 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-cyclopropyl-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-cyclopropyl-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3434453 |
| Molecular Formula | C20H14N4O5S2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | N-cyclopropyl-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)cc2s1)NC1CC1 |
| InChI | InChI=1S/C20H14N4O5S2/c25-17(21-10-1-2-10)9-30-20-22-15-6-4-11(8-16(15)31-20)23-18(26)13-5-3-12(24(28)29)7-14(13)19(23)27/h3-8,10H,1-2,9H2,(H,21,25) |
| InChIKey | MOGBNJGGWRICER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|