C25H18N4O5S2 — CID 2261616
N-(2,6-dimethylphenyl)-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 2261616) has the molecular formula C25H18N4O5S2 and a molecular weight of 518.58 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2261616 |
| Molecular Formula | C25H18N4O5S2 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[6-(5-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CSc1nc2ccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)cc2s1 |
| InChI | InChI=1S/C25H18N4O5S2/c1-13-4-3-5-14(2)22(13)27-21(30)12-35-25-26-19-9-7-15(11-20(19)36-25)28-23(31)17-8-6-16(29(33)34)10-18(17)24(28)32/h3-11H,12H2,1-2H3,(H,27,30) |
| InChIKey | BRHCOSFRNOATTQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|