C28H18ClN3O3S2 — CID 124530120
N-(3-chloro-4-methylphenyl)-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 124530120) has the molecular formula C28H18ClN3O3S2 and a molecular weight of 544.06 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 124530120 |
| Molecular Formula | C28H18ClN3O3S2 |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3ccc(N4C(=O)c5cccc6cccc(c56)C4=O)cc3s2)cc1Cl |
| InChI | InChI=1S/C28H18ClN3O3S2/c1-15-8-9-17(12-21(15)29)30-24(33)14-36-28-31-22-11-10-18(13-23(22)37-28)32-26(34)19-6-2-4-16-5-3-7-20(25(16)19)27(32)35/h2-13H,14H2,1H3,(H,30,33) |
| InChIKey | HBOFJXCUXOWORF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|