C29H16N4O6S2 — CID 124530517
N-dibenzofuran-3-yl-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide (PubChem CID 124530517) has the molecular formula C29H16N4O6S2 and a molecular weight of 580.60 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-dibenzofuran-3-yl-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 124530517 |
| Molecular Formula | C29H16N4O6S2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | N-dibenzofuran-3-yl-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2s1)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C29H16N4O6S2/c34-25(30-15-8-10-18-17-4-1-2-7-22(17)39-23(18)12-15)14-40-29-31-20-11-9-16(13-24(20)41-29)32-27(35)19-5-3-6-21(33(37)38)26(19)28(32)36/h1-13H,14H2,(H,30,34) |
| InChIKey | NOYMVMOOUHZZRJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|