C26H20N4O6S2 — CID 126343506
(2R)-N-(4-ethoxyphenyl)-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanamide (PubChem CID 126343506) has the molecular formula C26H20N4O6S2 and a molecular weight of 548.60 g/mol. Its IUPAC name is (2R)-N-(4-ethoxyphenyl)-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-(4-ethoxyphenyl)-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 126343506 |
| Molecular Formula | C26H20N4O6S2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | (2R)-N-(4-ethoxyphenyl)-2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](C)Sc2nc3ccc(N4C(=O)c5cccc([N+](=O)[O-])c5C4=O)cc3s2)cc1 |
| InChI | InChI=1S/C26H20N4O6S2/c1-3-36-17-10-7-15(8-11-17)27-23(31)14(2)37-26-28-19-12-9-16(13-21(19)38-26)29-24(32)18-5-4-6-20(30(34)35)22(18)25(29)33/h4-14H,3H2,1-2H3,(H,27,31)/t14-/m1/s1 |
| InChIKey | SWWMPDZLIFMKSO-CQSZACIVSA-N |
| XLogP | 5.52 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|