C23H13N5O7S2 — CID 126344062
2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 126344062) has the molecular formula C23H13N5O7S2 and a molecular weight of 535.52 g/mol. Its IUPAC name is 2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126344062 |
| Molecular Formula | C23H13N5O7S2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.03 |
| IUPAC Name | 2-[[6-(4-nitro-1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2s1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H13N5O7S2/c29-19(24-12-4-6-13(7-5-12)27(32)33)11-36-23-25-16-9-8-14(10-18(16)37-23)26-21(30)15-2-1-3-17(28(34)35)20(15)22(26)31/h1-10H,11H2,(H,24,29) |
| InChIKey | ZQCDXAOXXVIIDQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|