C27H16N4O5S2 — CID 23967279
2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 23967279) has the molecular formula C27H16N4O5S2 and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23967279 |
| Molecular Formula | C27H16N4O5S2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 2-[[6-(1,3-dioxobenzo[de]isoquinolin-2-yl)-1,3-benzothiazol-2-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4cccc5cccc(c45)C3=O)cc2s1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H16N4O5S2/c32-23(28-19-9-1-2-10-21(19)31(35)36)14-37-27-29-20-12-11-16(13-22(20)38-27)30-25(33)17-7-3-5-15-6-4-8-18(24(15)17)26(30)34/h1-13H,14H2,(H,28,32) |
| InChIKey | IEPCGRUSYKEPFJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|