C34H20N2O3S2 — CID 124530119
2-[2-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzo[de]isoquinoline-1,3-dione (PubChem CID 124530119) has the molecular formula C34H20N2O3S2 and a molecular weight of 568.68 g/mol. Its IUPAC name is 2-[2-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 124530119 |
| Molecular Formula | C34H20N2O3S2 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 2-[2-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C(CSc1nc2ccc(N3C(=O)c4cccc5cccc(c45)C3=O)cc2s1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C34H20N2O3S2/c37-29(21-11-13-25-22(16-21)15-20-5-1-2-8-24(20)25)18-40-34-35-28-14-12-23(17-30(28)41-34)36-32(38)26-9-3-6-19-7-4-10-27(31(19)26)33(36)39/h1-14,16-17H,15,18H2 |
| InChIKey | SUKOROOILZDONY-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|