C22H13BrN2O2S2 — CID 4235792
2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione (PubChem CID 4235792) has the molecular formula C22H13BrN2O2S2 and a molecular weight of 481.40 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4235792 |
| Molecular Formula | C22H13BrN2O2S2 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | 2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc2nc(SCc3ccc(Br)cc3)sc2c1 |
| InChI | InChI=1S/C22H13BrN2O2S2/c23-14-7-5-13(6-8-14)12-28-22-24-18-10-9-15(11-19(18)29-22)25-20(26)16-3-1-2-4-17(16)21(25)27/h1-11H,12H2 |
| InChIKey | TZAUUPPTGYDGOL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|