C14H11NOS2 — CID 14749857
2-benzylsulfanyl-1,3-benzothiazol-6-ol (PubChem CID 14749857) has the molecular formula C14H11NOS2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-benzylsulfanyl-1,3-benzothiazol-6-ol.
| Compound Name | 2-benzylsulfanyl-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 14749857 |
| Molecular Formula | C14H11NOS2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-benzylsulfanyl-1,3-benzothiazol-6-ol |
| SMILES | Oc1ccc2nc(SCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C14H11NOS2/c16-11-6-7-12-13(8-11)18-14(15-12)17-9-10-4-2-1-3-5-10/h1-8,16H,9H2 |
| InChIKey | FBYKBCGGJIGHFQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |