C21H15ClN2OS2 — CID 3542038
N-(2-benzylsulfanyl-1,3-benzothiazol-6-yl)-2-chlorobenzamide (PubChem CID 3542038) has the molecular formula C21H15ClN2OS2 and a molecular weight of 410.95 g/mol. Its IUPAC name is N-(2-benzylsulfanyl-1,3-benzothiazol-6-yl)-2-chlorobenzamide.
| Compound Name | N-(2-benzylsulfanyl-1,3-benzothiazol-6-yl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 3542038 |
| Molecular Formula | C21H15ClN2OS2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | N-(2-benzylsulfanyl-1,3-benzothiazol-6-yl)-2-chlorobenzamide |
| SMILES | O=C(Nc1ccc2nc(SCc3ccccc3)sc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C21H15ClN2OS2/c22-17-9-5-4-8-16(17)20(25)23-15-10-11-18-19(12-15)27-21(24-18)26-13-14-6-2-1-3-7-14/h1-12H,13H2,(H,23,25) |
| InChIKey | CLGOUCHYZYQFRY-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |