C17H12N3O4S2- — CID 7430883
2-[[2-(2-amino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]carbamoyl]benzoate (PubChem CID 7430883) has the molecular formula C17H12N3O4S2- and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[[2-(2-amino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]carbamoyl]benzoate.
| Compound Name | 2-[[2-(2-amino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 7430883 |
| Molecular Formula | C17H12N3O4S2- |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-[[2-(2-amino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]carbamoyl]benzoate |
| SMILES | NC(=O)CSc1nc2ccc(NC(=O)c3ccccc3C(=O)[O-])cc2s1 |
| InChI | InChI=1S/C17H13N3O4S2/c18-14(21)8-25-17-20-12-6-5-9(7-13(12)26-17)19-15(22)10-3-1-2-4-11(10)16(23)24/h1-7H,8H2,(H2,18,21)(H,19,22)(H,23,24)/p-1 |
| InChIKey | LWOCUSUIWBIPGG-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |