C13H9BrN2S2 — CID 117097310
2-benzylsulfanyl-6-bromo-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 117097310) has the molecular formula C13H9BrN2S2 and a molecular weight of 337.27 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-bromo-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-benzylsulfanyl-6-bromo-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 117097310 |
| Molecular Formula | C13H9BrN2S2 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 2-benzylsulfanyl-6-bromo-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Brc1cnc2sc(SCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C13H9BrN2S2/c14-10-6-11-12(15-7-10)18-13(16-11)17-8-9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | LXBATAPTIBXRDR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |