C11H10ClNS2 — CID 11021483
2-benzylsulfanyl-5-(chloromethyl)-1,3-thiazole (PubChem CID 11021483) has the molecular formula C11H10ClNS2 and a molecular weight of 255.80 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-benzylsulfanyl-5-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 11021483 |
| Molecular Formula | C11H10ClNS2 |
| Molecular Weight | 255.80 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 2-benzylsulfanyl-5-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1cnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C11H10ClNS2/c12-6-10-7-13-11(15-10)14-8-9-4-2-1-3-5-9/h1-5,7H,6,8H2 |
| InChIKey | HCKYRLWYBRUAHE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|