C13H10N4S2 — CID 2746820
2-benzylsulfanyl-5-pyrazin-2-yl-1,3,4-thiadiazole (PubChem CID 2746820) has the molecular formula C13H10N4S2 and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-pyrazin-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-benzylsulfanyl-5-pyrazin-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 2746820 |
| Molecular Formula | C13H10N4S2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-benzylsulfanyl-5-pyrazin-2-yl-1,3,4-thiadiazole |
| SMILES | c1ccc(CSc2nnc(-c3cnccn3)s2)cc1 |
| InChI | InChI=1S/C13H10N4S2/c1-2-4-10(5-3-1)9-18-13-17-16-12(19-13)11-8-14-6-7-15-11/h1-8H,9H2 |
| InChIKey | KHJKJOHJWSZGAB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |