C13H6Cl2N6O4S2 — CID 170925293
2-[(2,6-dichloro-3,5-dinitrophenyl)methylsulfanyl]-5-pyrazin-2-yl-1,3,4-thiadiazole (PubChem CID 170925293) has the molecular formula C13H6Cl2N6O4S2 and a molecular weight of 445.27 g/mol. Its IUPAC name is 2-[(2,6-dichloro-3,5-dinitrophenyl)methylsulfanyl]-5-pyrazin-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-[(2,6-dichloro-3,5-dinitrophenyl)methylsulfanyl]-5-pyrazin-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 170925293 |
| Molecular Formula | C13H6Cl2N6O4S2 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | 2-[(2,6-dichloro-3,5-dinitrophenyl)methylsulfanyl]-5-pyrazin-2-yl-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c(CSc2nnc(-c3cnccn3)s2)c1Cl |
| InChI | InChI=1S/C13H6Cl2N6O4S2/c14-10-6(11(15)9(21(24)25)3-8(10)20(22)23)5-26-13-19-18-12(27-13)7-4-16-1-2-17-7/h1-4H,5H2 |
| InChIKey | YBEGIHAKPKYOBW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 137.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|