C17H13ClN4O4S2 — CID 2548117
N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-nitrophenoxy)acetamide (PubChem CID 2548117) has the molecular formula C17H13ClN4O4S2 and a molecular weight of 436.90 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 2548117 |
| Molecular Formula | C17H13ClN4O4S2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1nnc(SCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H13ClN4O4S2/c18-12-7-5-11(6-8-12)10-27-17-21-20-16(28-17)19-15(23)9-26-14-4-2-1-3-13(14)22(24)25/h1-8H,9-10H2,(H,19,20,23) |
| InChIKey | GTWIOSUIAADIRL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|