C20H15FN4O2S2 — CID 2546469
N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-quinolin-8-yloxyacetamide (PubChem CID 2546469) has the molecular formula C20H15FN4O2S2 and a molecular weight of 426.50 g/mol. Its IUPAC name is N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 2546469 |
| Molecular Formula | C20H15FN4O2S2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-quinolin-8-yloxyacetamide |
| SMILES | O=C(COc1cccc2cccnc12)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H15FN4O2S2/c21-15-8-6-13(7-9-15)12-28-20-25-24-19(29-20)23-17(26)11-27-16-5-1-3-14-4-2-10-22-18(14)16/h1-10H,11-12H2,(H,23,24,26) |
| InChIKey | VTMPGBZEPGRQEM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|