C17H13F2N3OS2 — CID 23931767
2-(4-fluorophenyl)-N-[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 23931767) has the molecular formula C17H13F2N3OS2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23931767 |
| Molecular Formula | C17H13F2N3OS2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1nnc(SCc2cccc(F)c2)s1 |
| InChI | InChI=1S/C17H13F2N3OS2/c18-13-6-4-11(5-7-13)9-15(23)20-16-21-22-17(25-16)24-10-12-2-1-3-14(19)8-12/h1-8H,9-10H2,(H,20,21,23) |
| InChIKey | VORBKJHAPCWMBW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|