C19H16F2N6S4 — CID 72735470
N,N'-bis[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine (PubChem CID 72735470) has the molecular formula C19H16F2N6S4 and a molecular weight of 494.64 g/mol. Its IUPAC name is N,N'-bis[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine.
| Compound Name | N,N'-bis[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine |
|---|---|
| PubChem CID | 72735470 |
| Molecular Formula | C19H16F2N6S4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | N,N'-bis[5-[(3-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine |
| SMILES | Fc1cccc(CSc2nnc(NCNc3nnc(SCc4cccc(F)c4)s3)s2)c1 |
| InChI | InChI=1S/C19H16F2N6S4/c20-14-5-1-3-12(7-14)9-28-18-26-24-16(30-18)22-11-23-17-25-27-19(31-17)29-10-13-4-2-6-15(21)8-13/h1-8H,9-11H2,(H,22,24)(H,23,25) |
| InChIKey | YJXKTSXIBKNJMV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|