C16H23N3S2 — CID 110826865
N-hexyl-5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 110826865) has the molecular formula C16H23N3S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is N-hexyl-5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-hexyl-5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 110826865 |
| Molecular Formula | C16H23N3S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-hexyl-5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCCNc1nnc(SCc2cccc(C)c2)s1 |
| InChI | InChI=1S/C16H23N3S2/c1-3-4-5-6-10-17-15-18-19-16(21-15)20-12-14-9-7-8-13(2)11-14/h7-9,11H,3-6,10,12H2,1-2H3,(H,17,18) |
| InChIKey | JDJSFAFUDNMUCD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|