C22H23Cl2N3O2S2 — CID 18864726
3,5-dichloro-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide (PubChem CID 18864726) has the molecular formula C22H23Cl2N3O2S2 and a molecular weight of 496.49 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide.
| Compound Name | 3,5-dichloro-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 18864726 |
| Molecular Formula | C22H23Cl2N3O2S2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 3,5-dichloro-N-[5-[(3-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)Nc2nnc(SCc3cccc(C)c3)s2)cc1Cl |
| InChI | InChI=1S/C22H23Cl2N3O2S2/c1-3-4-5-9-29-19-17(23)11-16(12-18(19)24)20(28)25-21-26-27-22(31-21)30-13-15-8-6-7-14(2)10-15/h6-8,10-12H,3-5,9,13H2,1-2H3,(H,25,26,28) |
| InChIKey | KYUQUEYVBGJNFD-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|