C18H21Cl2N3O2S2 — CID 18848963
3,5-dichloro-4-hexoxy-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 18848963) has the molecular formula C18H21Cl2N3O2S2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 3,5-dichloro-4-hexoxy-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,5-dichloro-4-hexoxy-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18848963 |
| Molecular Formula | C18H21Cl2N3O2S2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 3,5-dichloro-4-hexoxy-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C=CCSc1nnc(NC(=O)c2cc(Cl)c(OCCCCCC)c(Cl)c2)s1 |
| InChI | InChI=1S/C18H21Cl2N3O2S2/c1-3-5-6-7-8-25-15-13(19)10-12(11-14(15)20)16(24)21-17-22-23-18(27-17)26-9-4-2/h4,10-11H,2-3,5-9H2,1H3,(H,21,22,24) |
| InChIKey | BFFMQIZRZICEGZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|