C17H21Cl2N3O2S — CID 18848765
4-butoxy-3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 18848765) has the molecular formula C17H21Cl2N3O2S and a molecular weight of 402.35 g/mol. Its IUPAC name is 4-butoxy-3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-butoxy-3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 18848765 |
| Molecular Formula | C17H21Cl2N3O2S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-butoxy-3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2nnc(CC(C)C)s2)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N3O2S/c1-4-5-6-24-15-12(18)8-11(9-13(15)19)16(23)20-17-22-21-14(25-17)7-10(2)3/h8-10H,4-7H2,1-3H3,(H,20,22,23) |
| InChIKey | KLZAZRKAMHDWOJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|