C14H15Cl2N3O2S2 — CID 18864985
3,5-dichloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide (PubChem CID 18864985) has the molecular formula C14H15Cl2N3O2S2 and a molecular weight of 392.33 g/mol. Its IUPAC name is 3,5-dichloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide.
| Compound Name | 3,5-dichloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 18864985 |
| Molecular Formula | C14H15Cl2N3O2S2 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 3,5-dichloro-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2nnc(SCC)s2)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O2S2/c1-3-5-21-11-9(15)6-8(7-10(11)16)12(20)17-13-18-19-14(23-13)22-4-2/h6-7H,3-5H2,1-2H3,(H,17,18,20) |
| InChIKey | OOLLVIMRFBSADB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|