C18H23Cl2N3O2S — CID 18848842
3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide (PubChem CID 18848842) has the molecular formula C18H23Cl2N3O2S and a molecular weight of 416.37 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide.
| Compound Name | 3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 18848842 |
| Molecular Formula | C18H23Cl2N3O2S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3,5-dichloro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)Nc2nnc(CC(C)C)s2)cc1Cl |
| InChI | InChI=1S/C18H23Cl2N3O2S/c1-4-5-6-7-25-16-13(19)9-12(10-14(16)20)17(24)21-18-23-22-15(26-18)8-11(2)3/h9-11H,4-8H2,1-3H3,(H,21,23,24) |
| InChIKey | UXXSYKNEAVJIDL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|