C22H24Cl2N2O2S — CID 18854102
3,5-dichloro-4-heptoxy-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 18854102) has the molecular formula C22H24Cl2N2O2S and a molecular weight of 451.42 g/mol. Its IUPAC name is 3,5-dichloro-4-heptoxy-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3,5-dichloro-4-heptoxy-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18854102 |
| Molecular Formula | C22H24Cl2N2O2S |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3,5-dichloro-4-heptoxy-N-(6-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)Nc2nc3ccc(C)cc3s2)cc1Cl |
| InChI | InChI=1S/C22H24Cl2N2O2S/c1-3-4-5-6-7-10-28-20-16(23)12-15(13-17(20)24)21(27)26-22-25-18-9-8-14(2)11-19(18)29-22/h8-9,11-13H,3-7,10H2,1-2H3,(H,25,26,27) |
| InChIKey | OYUVZINLEYXOAB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|