C23H17N5O2S2 — CID 4652334
2-N,5-N-bis(6-methyl-1,3-benzothiazol-2-yl)pyridine-2,5-dicarboxamide (PubChem CID 4652334) has the molecular formula C23H17N5O2S2 and a molecular weight of 459.56 g/mol. Its IUPAC name is 2-N,5-N-bis(6-methyl-1,3-benzothiazol-2-yl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(6-methyl-1,3-benzothiazol-2-yl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4652334 |
| Molecular Formula | C23H17N5O2S2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2-N,5-N-bis(6-methyl-1,3-benzothiazol-2-yl)pyridine-2,5-dicarboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3ccc(C(=O)Nc4nc5ccc(C)cc5s4)nc3)sc2c1 |
| InChI | InChI=1S/C23H17N5O2S2/c1-12-3-6-15-18(9-12)31-22(25-15)27-20(29)14-5-8-17(24-11-14)21(30)28-23-26-16-7-4-13(2)10-19(16)32-23/h3-11H,1-2H3,(H,25,27,29)(H,26,28,30) |
| InChIKey | WLJMYRXCVMKCQM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |