C35H25N5O2S2 — CID 4071461
2-N,5-N-bis[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-2,5-dicarboxamide (PubChem CID 4071461) has the molecular formula C35H25N5O2S2 and a molecular weight of 611.75 g/mol. Its IUPAC name is 2-N,5-N-bis[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4071461 |
| Molecular Formula | C35H25N5O2S2 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | 2-N,5-N-bis[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-2,5-dicarboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4ccc(C(=O)Nc5ccc(-c6nc7ccc(C)cc7s6)cc5)nc4)cc3)sc2c1 |
| InChI | InChI=1S/C35H25N5O2S2/c1-20-3-14-27-30(17-20)43-34(39-27)22-5-10-25(11-6-22)37-32(41)24-9-16-29(36-19-24)33(42)38-26-12-7-23(8-13-26)35-40-28-15-4-21(2)18-31(28)44-35/h3-19H,1-2H3,(H,37,41)(H,38,42) |
| InChIKey | MAIKZXMQTXMPJH-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |