C25H23N3O2S — CID 2952764
4-(butanoylamino)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide (PubChem CID 2952764) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-(butanoylamino)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide.
| Compound Name | 4-(butanoylamino)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 2952764 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-(butanoylamino)-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O2S/c1-3-4-23(29)26-19-10-6-17(7-11-19)24(30)27-20-12-8-18(9-13-20)25-28-21-14-5-16(2)15-22(21)31-25/h5-15H,3-4H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | XJSOXHGVJGZKJE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |