C20H14FN3OS — CID 58342198
6-(18F)fluoro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-3-carboxamide (PubChem CID 58342198) has the molecular formula C20H14FN3OS and a molecular weight of 362.42 g/mol. Its IUPAC name is 6-(18F)fluoro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(18F)fluoro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58342198 |
| Molecular Formula | C20H14FN3OS |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 6-(18F)fluoro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)c4ccc([18F])nc4)cc3)sc2c1 |
| InChI | InChI=1S/C20H14FN3OS/c1-12-2-8-16-17(10-12)26-20(24-16)13-3-6-15(7-4-13)23-19(25)14-5-9-18(21)22-11-14/h2-11H,1H3,(H,23,25)/i21-1 |
| InChIKey | UCQBNZWMGDNFIS-GJQNQZCXSA-N |
| XLogP | 5.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|