C22H19N3OS — CID 91217889
3-amino-5-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide (PubChem CID 91217889) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-amino-5-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide.
| Compound Name | 3-amino-5-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 91217889 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-amino-5-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]benzamide |
| SMILES | Cc1cc(N)cc(C(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)c1 |
| InChI | InChI=1S/C22H19N3OS/c1-13-3-8-19-20(11-13)27-22(25-19)15-4-6-18(7-5-15)24-21(26)16-9-14(2)10-17(23)12-16/h3-12H,23H2,1-2H3,(H,24,26) |
| InChIKey | QPSPYEDXHIURCP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|