C16H13IN2OS — CID 5155423
2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide (PubChem CID 5155423) has the molecular formula C16H13IN2OS and a molecular weight of 408.26 g/mol. Its IUPAC name is 2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide.
| Compound Name | 2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 5155423 |
| Molecular Formula | C16H13IN2OS |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 2-iodo-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]acetamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)CI)cc3)sc2c1 |
| InChI | InChI=1S/C16H13IN2OS/c1-10-2-7-13-14(8-10)21-16(19-13)11-3-5-12(6-4-11)18-15(20)9-17/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | PKLHKGNTARKGAK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|