C22H19N3OS — CID 108888002
1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 108888002) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 108888002 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)c1 |
| InChI | InChI=1S/C22H19N3OS/c1-14-4-3-5-18(12-14)24-22(26)23-17-9-7-16(8-10-17)21-25-19-11-6-15(2)13-20(19)27-21/h3-13H,1-2H3,(H2,23,24,26) |
| InChIKey | CESCZLYXKFYCMW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |